CAS 1260832-24-3 is the registry number for 6-Iodochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1260832-24-3) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: 6-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: LCIGITRGKYZQPB-UHFFFAOYSA-N.
| Molecular formula | C10H9IO3 |
|---|---|
| Molecular weight | 304.08 g/mol |
| IUPAC name | 6-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | LCIGITRGKYZQPB-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=C(C=C2)I)C(=O)O |
Computed by PubChem (NCBI)