Products 1260832-24-3

CAS 1260832-24-3 is the registry number for 6-Iodochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1260832-24-3) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: 6-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: LCIGITRGKYZQPB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO3
Molecular weight304.08 g/mol
IUPAC name6-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyLCIGITRGKYZQPB-UHFFFAOYSA-N
SMILESC1C(COC2=C1C=C(C=C2)I)C(=O)O

Computed by PubChem (NCBI)