Products 847949-06-8
CAS 847949-06-8 is the registry number for Methyl 5-iodo-2,3-dihydrobenzofuran-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-iodo-2,3-dihydro-1-benzofuran-2-carboxylate (CAS 847949-06-8) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: methyl 5-iodo-2,3-dihydro-1-benzofuran-2-carboxylate. InChIKey: ZBRHMPOUFPWPEA-UHFFFAOYSA-N.
| Molecular formula | C10H9IO3 |
|---|---|
| Molecular weight | 304.08 g/mol |
| IUPAC name | methyl 5-iodo-2,3-dihydro-1-benzofuran-2-carboxylate |
| InChIKey | ZBRHMPOUFPWPEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(O1)C=CC(=C2)I |
Computed by PubChem (NCBI)