CAS 888958-33-6 is the registry number for 6-Iodo-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-2,2-dimethyl-1,3-benzodioxin-4-one (CAS 888958-33-6) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: 6-iodo-2,2-dimethyl-1,3-benzodioxin-4-one. InChIKey: QNDFFFLRKOLQEP-UHFFFAOYSA-N.
| Molecular formula | C10H9IO3 |
|---|---|
| Molecular weight | 304.08 g/mol |
| IUPAC name | 6-iodo-2,2-dimethyl-1,3-benzodioxin-4-one |
| InChIKey | QNDFFFLRKOLQEP-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(C=C(C=C2)I)C(=O)O1)C |
Computed by PubChem (NCBI)