Products 2666400-10-6

CAS 2666400-10-6 is the registry number for 3-(3-Iodo-2-methylphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3-iodo-2-methylphenyl)-2-oxopropanoic acid (CAS 2666400-10-6) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: 3-(3-iodo-2-methylphenyl)-2-oxopropanoic acid. InChIKey: LFHANZSPVKGXAR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO3
Molecular weight304.08 g/mol
IUPAC name3-(3-iodo-2-methylphenyl)-2-oxopropanoic acid
InChIKeyLFHANZSPVKGXAR-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1I)CC(=O)C(=O)O

Computed by PubChem (NCBI)