Products 1822633-85-1

CAS 1822633-85-1 is the registry number for 7-Iodochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1822633-85-1) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: 7-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: BTJIGHWOTNTBST-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO3
Molecular weight304.08 g/mol
IUPAC name7-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyBTJIGHWOTNTBST-UHFFFAOYSA-N
SMILESC1C(COC2=C1C=CC(=C2)I)C(=O)O

Computed by PubChem (NCBI)