cas: 152626-75-0 — see every product listed under this CAS number, including other names
6-METHOXY-5-NITRO (1H)INDAZOLE, 98% (CAS 152626-75-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F793502-100MG |
| cas | 152626-75-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1205.84 Pln | |
| Fluorochem | 10g | 2236.73 Pln | |
| Fluorochem | 25g | 4538.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxy-5-nitro-1H-indazole (CAS 152626-75-0) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 6-methoxy-5-nitro-1H-indazole. InChIKey: QULAONDBWZZTOI-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 6-methoxy-5-nitro-1H-indazole |
| InChIKey | QULAONDBWZZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)