cas: 152626-75-0 — see every product listed under this CAS number, including other names
6-Methoxy-5-nitro-1H-indazole, 95%, 95% (CAS 152626-75-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145D0-100mg |
| cas | 152626-75-0 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 678.80 Pln | |
| Chemat | 10g | 1091.60 Pln | |
| Chemat | 25g | 2118.80 Pln | |
| Chemat | 100g | 5315.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-5-nitro-1H-indazole (CAS 152626-75-0) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 6-methoxy-5-nitro-1H-indazole. InChIKey: QULAONDBWZZTOI-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 6-methoxy-5-nitro-1H-indazole |
| InChIKey | QULAONDBWZZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)