cas: 120800-52-4 — see every product listed under this CAS number, including other names
6-MORPHOLINONICOTINIC ACID, 98%, 98% (CAS 120800-52-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SEI-250mg |
| cas | 120800-52-4 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 395.60 Pln | |
| Chemat | 25g | 1691.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-morpholin-4-ylpyridine-3-carboxylic acid (CAS 120800-52-4) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 6-morpholin-4-ylpyridine-3-carboxylic acid. InChIKey: XXDSDFLDYNISKD-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-morpholin-4-ylpyridine-3-carboxylic acid |
| InChIKey | XXDSDFLDYNISKD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)