cas: 120800-52-4 — see every product listed under this CAS number, including other names
6-Morpholinonicotinic acid 98% (CAS 120800-52-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A876430-250mg |
| cas | 120800-52-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 25g | 2194.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A876430 |
6-morpholin-4-ylpyridine-3-carboxylic acid (CAS 120800-52-4) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 6-morpholin-4-ylpyridine-3-carboxylic acid. InChIKey: XXDSDFLDYNISKD-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-morpholin-4-ylpyridine-3-carboxylic acid |
| InChIKey | XXDSDFLDYNISKD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)