CAS 5464-10-8 is the registry number for 6-Methoxy-2-methyl-2,3-dihydro-1H-inden-1-one, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-methoxy-2-methyl-2,3-dihydroinden-1-one (CAS 5464-10-8) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 6-methoxy-2-methyl-2,3-dihydroinden-1-one. InChIKey: VXKMGRRBRAIZKF-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-methoxy-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | VXKMGRRBRAIZKF-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=C(C=C2)OC |
Computed by PubChem (NCBI)