CAS 182570-26-9 appears in our catalog under these names: 6-Methoxy-chroman-3-carboxylic acid, 97%, 6–Methoxychroman–3–carboxylic acid, 6-Methoxychroman-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 182570-26-9) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: YFYLMFXPYODSEB-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | YFYLMFXPYODSEB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC(C2)C(=O)O |
Computed by PubChem (NCBI)