Products 182570-28-1
CAS 182570-28-1 appears in our catalog under these names: (S)-6-Methoxychroman-3-carboxylic acid, 95%, (S)-6-Methoxychroman-3-carboxylic acid, 98%, (S)-6-Methoxychroman-3-carboxylic acid/ 100%, (S)-6-Methoxychroman-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, TargetMol, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 1mg, 5mg, 10mg, 25mg.
(3S)-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 182570-28-1) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (3S)-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: YFYLMFXPYODSEB-QMMMGPOBSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (3S)-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | YFYLMFXPYODSEB-QMMMGPOBSA-N |
| SMILES | COC1=CC2=C(C=C1)OC[C@H](C2)C(=O)O |
Computed by PubChem (NCBI)