cas: 66354-87-8 — see every product listed under this CAS number, including other names
6-Methyl-2-phenyl-1H-indole, ≥97-<99% (CAS 66354-87-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC7385-97-99-5g |
| cas | 66354-87-8 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 5909.64 Pln | |
| Hoffman Fine Chemicals | 10g | 9271.90 Pln | |
| Hoffman Fine Chemicals | 25g | 18235.80 Pln | |
| Hoffman Fine Chemicals | 50g | 28986.10 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
6-methyl-2-phenyl-1H-indole (CAS 66354-87-8) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 6-methyl-2-phenyl-1H-indole. InChIKey: WHOVJSPCXWJPBL-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 6-methyl-2-phenyl-1H-indole |
| InChIKey | WHOVJSPCXWJPBL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)