cas: 41959-35-7 — see every product listed under this CAS number, including other names
6-Nitro-1,2,3,4-tetrahydroquinoxaline, 98%, 98% (CAS 41959-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8A1-100mg |
| cas | 41959-35-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 10g | 1091.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-nitro-1,2,3,4-tetrahydroquinoxaline (CAS 41959-35-7) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 6-nitro-1,2,3,4-tetrahydroquinoxaline. InChIKey: ZVDCYZVYRXZJQF-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 6-nitro-1,2,3,4-tetrahydroquinoxaline |
| InChIKey | ZVDCYZVYRXZJQF-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(N1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)