cas: 213113-45-2 — see every product listed under this CAS number, including other names
6-Nitro-2(1H)-pyridinone, 97%, 97% (CAS 213113-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118QUI-100mg |
| cas | 213113-45-2 |
| size | 100mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 1038.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-nitro-1H-pyridin-2-one (CAS 213113-45-2) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 6-nitro-1H-pyridin-2-one. InChIKey: XVVDYCAYALHWBJ-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 6-nitro-1H-pyridin-2-one |
| InChIKey | XVVDYCAYALHWBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)