cas: 1368348-22-4 — see every product listed under this CAS number, including other names
6-cyclopentyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 97% (CAS 1368348-22-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A712783-5g |
| cas | 1368348-22-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22243.06 Pln | |
| AmBeed | 10g | 37053.31 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid (CAS 1368348-22-4) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid. InChIKey: ZWGYOHPDCCVFIQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid |
| InChIKey | ZWGYOHPDCCVFIQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=CC(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)