CAS 350014-18-5 is the registry number for Methyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate (CAS 350014-18-5) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: methyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate. InChIKey: HWLKUJXDHHWAIQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | methyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| InChIKey | HWLKUJXDHHWAIQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2=C(CCN1)C=C(C=C2)O |
Computed by PubChem (NCBI)