CAS 91133-47-0 is the registry number for 6,7-Dimethoxy-3,4-dihydroquinolin-2(1h)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one (CAS 91133-47-0) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one. InChIKey: VYWZXGKPKYGBHI-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 6,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | VYWZXGKPKYGBHI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC(=O)N2)OC |
Computed by PubChem (NCBI)