CAS 1368348-22-4 appears in our catalog under these names: 6-Cyclopentyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 95%, 6-cyclopentyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 100mg, 5g, 250mg.
2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid (CAS 1368348-22-4) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid. InChIKey: ZWGYOHPDCCVFIQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-cyclopentyl-6-oxo-1H-pyridine-4-carboxylic acid |
| InChIKey | ZWGYOHPDCCVFIQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=CC(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)