CAS 1499-53-2 appears in our catalog under these names: ETHYL 2-BENZAMIDOACETATE, 98%, Ethyl 2-benzamidoacetate, 95+%, 95+%, Ethyl hippurate, 98%, ETHYL HIPPURATE, Ethyl hippurate, 96% . Offered by: Fluorochem, Chemat, Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 25g, 100g, 1g, 500g, 250mg.
Ethyl 2-benzamidoacetate (CAS 1499-53-2) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 2-benzamidoacetate. InChIKey: PTXRQIPIELXJFH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 2-benzamidoacetate |
| InChIKey | PTXRQIPIELXJFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)