CAS 23082-14-6 appears in our catalog under these names: (3,5-Dimethyl-benzoylamino)-acetic acid, 95%, 2-(3,5-Dimethylbenzamido)acetic acid, 97%, 2-((3,5-Dimethylphenyl)formamido)acetic acid, 3,5-Dimethylhippuric acid. Offered by: Combi-blocks, AmBeed, Biosynth, HPC Standards. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 1x50mg.
2-[(3,5-dimethylbenzoyl)amino]acetic acid (CAS 23082-14-6) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 2-[(3,5-dimethylbenzoyl)amino]acetic acid. InChIKey: GXECYTYPWZCYKI-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-[(3,5-dimethylbenzoyl)amino]acetic acid |
| InChIKey | GXECYTYPWZCYKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)NCC(=O)O)C |
Computed by PubChem (NCBI)