cas: 56406-26-9 — see every product listed under this CAS number, including other names
6-oxo-2-phenyl-1,6-dihydropyrimidine-5-carboxylic acid, 97% (CAS 56406-26-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F792060-250MG |
| cas | 56406-26-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 2819.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-oxo-2-phenyl-1H-pyrimidine-5-carboxylic acid (CAS 56406-26-9) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 6-oxo-2-phenyl-1H-pyrimidine-5-carboxylic acid. InChIKey: HADBIMYTRIMUAO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 6-oxo-2-phenyl-1H-pyrimidine-5-carboxylic acid |
| InChIKey | HADBIMYTRIMUAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)