cas: 1160246-92-3 — see every product listed under this CAS number, including other names
7-(1,1-Dimethylethyl) 2-oxa-7-azaspiro[4.5]decane-3,7-dicarboxylate, 97%, 97% (CAS 1160246-92-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HD80-25mg |
| cas | 1160246-92-3 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 578.00 Pln | |
| Chemat | 50mg | 736.40 Pln | |
| Chemat | 100mg | 938.00 Pln | |
| Chemat | 250mg | 1466.00 Pln | |
| Chemat | 500mg | 2627.60 Pln | |
| Chemat | 1g | 3563.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-9-azaspiro[4.5]decane-3-carboxylic acid (CAS 1160246-92-3) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 9-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-9-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: XWLXLEQWTDDMRL-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 9-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-9-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | XWLXLEQWTDDMRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CC(OC2)C(=O)O |
Computed by PubChem (NCBI)