cas: 1160246-92-3 — see every product listed under this CAS number, including other names
7-(tert-Butoxycarbonyl)-2-oxa-7-azaspiro-[4.5]decane-3-carboxylic acid 97% (CAS 1160246-92-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A645093-25mg |
| cas | 1160246-92-3 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 654.06 Pln | |
| Ambeed | 50mg | 843.19 Pln | |
| Ambeed | 100mg | 1087.94 Pln | |
| Ambeed | 250mg | 1699.81 Pln | |
| Ambeed | 1g | 4130.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A645093 |
9-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-9-azaspiro[4.5]decane-3-carboxylic acid (CAS 1160246-92-3) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 9-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-9-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: XWLXLEQWTDDMRL-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 9-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-9-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | XWLXLEQWTDDMRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CC(OC2)C(=O)O |
Computed by PubChem (NCBI)