cas: 1469894-57-2 — see every product listed under this CAS number, including other names
7-(tert-Butoxy)-7-oxoheptanoic acid 98% (CAS 1469894-57-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A430437-250mg |
| cas | 1469894-57-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 987.81 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| Ambeed | 25g | 3290.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A430437 |
7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid (CAS 1469894-57-2) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid. InChIKey: QUTDCEYUFAPSIR-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
| InChIKey | QUTDCEYUFAPSIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCC(=O)O |
Computed by PubChem (NCBI)