7-Bromo-3-chloropyrido[2,3-b]pyrazine, 97%
cas: 1240594-95-9 — see every product listed under this CAS number, including other names
7-Bromo-3-chloropyrido[2,3-b]pyrazine, 97% (CAS 1240594-95-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A676450-250mg |
| cas | 1240594-95-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1811.06 Pln | |
| Ambeed | 1g | 2912.44 Pln | |
| Chemat | 50mg | 251.60 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 500mg | 832.40 Pln | |
| BLDpharm | 50mg | 719.77 Pln | |
| BLDpharm | 100mg | 1175.17 Pln | |
| BLDpharm | 250mg | 1947.12 Pln | |
| BLDpharm | 1g | 3135.59 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
7-bromo-3-chloropyrido[2,3-b]pyrazine (CAS 1240594-95-9) is a chemical compound with the molecular formula C7H3BrClN3 and a molecular weight of 244.47 g/mol. IUPAC name: 7-bromo-3-chloropyrido[2,3-b]pyrazine. InChIKey: RIKFTUYVFVZVQA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3 |
|---|---|
| Molecular weight | 244.47 g/mol |
| IUPAC name | 7-bromo-3-chloropyrido[2,3-b]pyrazine |
| InChIKey | RIKFTUYVFVZVQA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NC(=CN=C21)Cl)Br |
Computed by PubChem (NCBI)