CAS 1431873-00-5 is the registry number for 3-bromo-6-chloropyrido[2,3-b]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-6-chloropyrido[2,3-b]pyrazine (CAS 1431873-00-5) is a chemical compound with the molecular formula C7H3BrClN3 and a molecular weight of 244.47 g/mol. IUPAC name: 3-bromo-6-chloropyrido[2,3-b]pyrazine. InChIKey: FQUJGEAANPWVBL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3 |
|---|---|
| Molecular weight | 244.47 g/mol |
| IUPAC name | 3-bromo-6-chloropyrido[2,3-b]pyrazine |
| InChIKey | FQUJGEAANPWVBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC(=CN=C21)Br)Cl |
Computed by PubChem (NCBI)