CAS 1590409-71-4 appears in our catalog under these names: 8-Bromo-5-chloropyrido(3,4-b)pyrazine, 97%, 8-Bromo-5-chloropyrido[3,4-b]pyrazine, 97%, 97%, 8-Bromo-5-chloropyrido[3,4-b]pyrazine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg, 500mg.
8-bromo-5-chloropyrido[3,4-b]pyrazine (CAS 1590409-71-4) is a chemical compound with the molecular formula C7H3BrClN3 and a molecular weight of 244.47 g/mol. IUPAC name: 8-bromo-5-chloropyrido[3,4-b]pyrazine. InChIKey: ZSTKKKPXYZGKPI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3 |
|---|---|
| Molecular weight | 244.47 g/mol |
| IUPAC name | 8-bromo-5-chloropyrido[3,4-b]pyrazine |
| InChIKey | ZSTKKKPXYZGKPI-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=CN=C2Cl)Br |
Computed by PubChem (NCBI)