Products 1240594-95-9
CAS 1240594-95-9 appears in our catalog under these names: 7-Bromo-3-chloropyrido[2,3-b]pyrazine, 97%, 97%, 7-bromo-3-chloro-pyrido[2,3-b]pyrazine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
7-bromo-3-chloropyrido[2,3-b]pyrazine (CAS 1240594-95-9) is a chemical compound with the molecular formula C7H3BrClN3 and a molecular weight of 244.47 g/mol. IUPAC name: 7-bromo-3-chloropyrido[2,3-b]pyrazine. InChIKey: RIKFTUYVFVZVQA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3 |
|---|---|
| Molecular weight | 244.47 g/mol |
| IUPAC name | 7-bromo-3-chloropyrido[2,3-b]pyrazine |
| InChIKey | RIKFTUYVFVZVQA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NC(=CN=C21)Cl)Br |
Computed by PubChem (NCBI)