CAS 2759952-13-9 is the registry number for 7-Bromo-4-chloropyrido[3,2-c]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4-chloropyrido[3,2-c]pyridazine (CAS 2759952-13-9) is a chemical compound with the molecular formula C7H3BrClN3 and a molecular weight of 244.47 g/mol. IUPAC name: 7-bromo-4-chloropyrido[3,2-c]pyridazine. InChIKey: WAZSFXZLVRYKJN-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3 |
|---|---|
| Molecular weight | 244.47 g/mol |
| IUPAC name | 7-bromo-4-chloropyrido[3,2-c]pyridazine |
| InChIKey | WAZSFXZLVRYKJN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=NC=C2Cl)Br |
Computed by PubChem (NCBI)