CAS 1352926-12-5 is the registry number for 8-Bromo-5-chloropyrido(4,3-d)pyrimidine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
8-bromo-5-chloropyrido[4,3-d]pyrimidine (CAS 1352926-12-5) is a chemical compound with the molecular formula C7H3BrClN3 and a molecular weight of 244.47 g/mol. IUPAC name: 8-bromo-5-chloropyrido[4,3-d]pyrimidine. InChIKey: GWPDGSQZFZZYCQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3 |
|---|---|
| Molecular weight | 244.47 g/mol |
| IUPAC name | 8-bromo-5-chloropyrido[4,3-d]pyrimidine |
| InChIKey | GWPDGSQZFZZYCQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC=N1)C(=CN=C2Cl)Br |
Computed by PubChem (NCBI)