cas: 1260847-61-7 — see every product listed under this CAS number, including other names
7-Bromo-4,6-dichloroquinazoline, 98%, 98% (CAS 1260847-61-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RFH-100mg |
| cas | 1260847-61-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 2598.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-4,6-dichloroquinazoline (CAS 1260847-61-7) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 7-bromo-4,6-dichloroquinazoline. InChIKey: NWCDKWJWCZLWQJ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 7-bromo-4,6-dichloroquinazoline |
| InChIKey | NWCDKWJWCZLWQJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)N=CN=C2Cl |
Computed by PubChem (NCBI)