cas: 1226879-79-3 — see every product listed under this CAS number, including other names
7-Bromo-6-methoxyisoindolin-1-one, 97% (CAS 1226879-79-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497917-100MG |
| cas | 1226879-79-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 919.49 Pln | |
| Fluorochem | 250mg | 2184.67 Pln | |
| Fluorochem | 1g | 4782.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-6-methoxy-2,3-dihydroisoindol-1-one (CAS 1226879-79-3) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 7-bromo-6-methoxy-2,3-dihydroisoindol-1-one. InChIKey: CLUBNXMGJUOTNO-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 7-bromo-6-methoxy-2,3-dihydroisoindol-1-one |
| InChIKey | CLUBNXMGJUOTNO-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CNC2=O)C=C1)Br |
Computed by PubChem (NCBI)