cas: 1416372-61-6 — see every product listed under this CAS number, including other names
7-Chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid 96% (CAS 1416372-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A647379-100mg |
| cas | 1416372-61-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 687.44 Pln | |
| Ambeed | 250mg | 1110.19 Pln | |
| Ambeed | 1g | 2879.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A647379 |
7-chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid (CAS 1416372-61-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: VEVCJRCPPKTPJN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | VEVCJRCPPKTPJN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)C(=O)O)C=C1Cl |
Computed by PubChem (NCBI)