CAS 208922-47-8 appears in our catalog under these names: (2E)-3-(2-Fluorophenyl)acryloyl chloride, 97%, (E)-3-(2-Fluoro-phenyl)-acryloyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 250mg.
(E)-3-(2-fluorophenyl)prop-2-enoyl chloride (CAS 208922-47-8) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: (E)-3-(2-fluorophenyl)prop-2-enoyl chloride. InChIKey: JTDODVLEWOIHOB-AATRIKPKSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | (E)-3-(2-fluorophenyl)prop-2-enoyl chloride |
| InChIKey | JTDODVLEWOIHOB-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)Cl)F |
Computed by PubChem (NCBI)