Products 881189-75-9
CAS 881189-75-9 appears in our catalog under these names: 6-Chloro-5-fluoro-2,3-dihydro-1h-inden-1-one, 95%, 6–Chloro–5–fluoro–2，3–dihydro–1H–inden–1–one, 6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one 95%, 6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-chloro-5-fluoro-2,3-dihydroinden-1-one (CAS 881189-75-9) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 6-chloro-5-fluoro-2,3-dihydroinden-1-one. InChIKey: KSPREBGZJITQJG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 6-chloro-5-fluoro-2,3-dihydroinden-1-one |
| InChIKey | KSPREBGZJITQJG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)F)Cl |
Computed by PubChem (NCBI)