Products 174603-49-7
CAS 174603-49-7 appears in our catalog under these names: 6-Chloro-4-fluoro-2,3-dihydro-1h-inden-1-one, 95%, 6-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-one, 97%, 6–Chloro–4–fluoro–2，3–dihydro–1H–inden–1–one, 6-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-one, 6-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-one, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 2,5g.
6-chloro-4-fluoro-2,3-dihydroinden-1-one (CAS 174603-49-7) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 6-chloro-4-fluoro-2,3-dihydroinden-1-one. InChIKey: JVRRTZQZQGXYPJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 6-chloro-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | JVRRTZQZQGXYPJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)Cl)F |
Computed by PubChem (NCBI)