CAS 2222137-89-3 is the registry number for 7-Chloro-6-nitrofuro[3,2-b]pyridine, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chloro-6-nitrofuro[3,2-b]pyridine (CAS 2222137-89-3) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 7-chloro-6-nitrofuro[3,2-b]pyridine. InChIKey: AQCQKDBQDZRGAH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 7-chloro-6-nitrofuro[3,2-b]pyridine |
| InChIKey | AQCQKDBQDZRGAH-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C(=CN=C21)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)