Products 1175514-11-0

CAS 1175514-11-0 is the registry number for 7-Ethynyl-2-oxo-2H-chromene-3-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

7-ethynyl-2-oxochromene-3-carboxylic acid (CAS 1175514-11-0) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: 7-ethynyl-2-oxochromene-3-carboxylic acid. InChIKey: FWOSUTJNTQHMIL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6O4
Molecular weight214.17 g/mol
IUPAC name7-ethynyl-2-oxochromene-3-carboxylic acid
InChIKeyFWOSUTJNTQHMIL-UHFFFAOYSA-N
SMILESC#CC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O

Computed by PubChem (NCBI)