cas: 111477-98-6 — see every product listed under this CAS number, including other names
7-Fluoro-2,2-dimethylchroman-4-one, 97% (CAS 111477-98-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F496866-100MG |
| cas | 111477-98-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 497.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
7-fluoro-2,2-dimethyl-3H-chromen-4-one (CAS 111477-98-6) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 7-fluoro-2,2-dimethyl-3H-chromen-4-one. InChIKey: MWTQZPUQPCIGJM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 7-fluoro-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | MWTQZPUQPCIGJM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=C(C=C2)F)C |
Computed by PubChem (NCBI)