7-Fluoro-6-methoxyisoindolin-1-one, 97%, 97%
cas: 1007455-31-3 — see every product listed under this CAS number, including other names
7-Fluoro-6-methoxyisoindolin-1-one, 97%, 97% (CAS 1007455-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1113RH-100mg |
| cas | 1007455-31-3 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 500mg | 558.80 Pln | |
| Chemat | 1g | 803.60 Pln | |
| Chemat | 5g | 2286.80 Pln | |
| Chemat | 10g | 3770.00 Pln | |
| Chemat | 25g | 7475.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-fluoro-6-methoxy-2,3-dihydroisoindol-1-one (CAS 1007455-31-3) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 7-fluoro-6-methoxy-2,3-dihydroisoindol-1-one. InChIKey: PBMQYRIHNKEHPH-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 7-fluoro-6-methoxy-2,3-dihydroisoindol-1-one |
| InChIKey | PBMQYRIHNKEHPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CNC2=O)C=C1)F |
Computed by PubChem (NCBI)