7-Fluoro-6-methoxyisoindolin-1-one, 97%
cas: 1007455-31-3 — see every product listed under this CAS number, including other names
7-Fluoro-6-methoxyisoindolin-1-one, 97% (CAS 1007455-31-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 100mg, 500mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A703820-250mg |
| cas | 1007455-31-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 467.11 Pln | |
| AmBeed | 25g | 18603.97 Pln | |
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 565.44 Pln | |
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1299.56 Pln | |
| Fluorochem | 5g | 3762.23 Pln | |
| Fluorochem | 10g | 6219.70 Pln | |
| Fluorochem | 25g | 12352.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-fluoro-6-methoxy-2,3-dihydroisoindol-1-one (CAS 1007455-31-3) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 7-fluoro-6-methoxy-2,3-dihydroisoindol-1-one. InChIKey: PBMQYRIHNKEHPH-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 7-fluoro-6-methoxy-2,3-dihydroisoindol-1-one |
| InChIKey | PBMQYRIHNKEHPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CNC2=O)C=C1)F |
Computed by PubChem (NCBI)