CAS 80937-24-2 appears in our catalog under these names: (E)-4-(2-Nitrophenyl)-4-oxobut-2-enoic acid, 95+%, (E)-4-(2-Nitrophenyl)-4-oxobut-2-enoic acid, 95.0%. Offered by: AmBeed, MedChemExpress. Available pack sizes: 1g, 100 mg, 500 mg, 250 mg.
(E)-4-(2-nitrophenyl)-4-oxobut-2-enoic acid (CAS 80937-24-2) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: (E)-4-(2-nitrophenyl)-4-oxobut-2-enoic acid. InChIKey: PBLUZBCDLSSYAR-AATRIKPKSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | (E)-4-(2-nitrophenyl)-4-oxobut-2-enoic acid |
| InChIKey | PBLUZBCDLSSYAR-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)