CAS 1402928-82-8 is the registry number for 8-Amino-2,5,7-trihydroxy-1,4-naphthalenedione. Offered by: TRC. Available pack sizes: 25mg.
8-amino-4,5,7-trihydroxynaphthalene-1,2-dione (CAS 1402928-82-8) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 8-amino-4,5,7-trihydroxynaphthalene-1,2-dione. InChIKey: GGZVNPWKYQUZKH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 8-amino-4,5,7-trihydroxynaphthalene-1,2-dione |
| InChIKey | GGZVNPWKYQUZKH-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1O)N)C(=O)C(=O)C=C2O)O |
Computed by PubChem (NCBI)