CAS 19037-68-4 appears in our catalog under these names: 7–HYDROXY–4–METHYL–6–NITROCOUMARIN, 7-Hydroxy-4-methyl-6-nitro-2H-chromen-2-one, 91%, 91%, 7-Hydroxy-4-methyl-6-nitro-2H-chromen-2-one. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
7-hydroxy-4-methyl-6-nitrochromen-2-one (CAS 19037-68-4) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 7-hydroxy-4-methyl-6-nitrochromen-2-one. InChIKey: DPLGBPYLXGFDJY-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 7-hydroxy-4-methyl-6-nitrochromen-2-one |
| InChIKey | DPLGBPYLXGFDJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=CC(=C(C=C12)[N+](=O)[O-])O |
Computed by PubChem (NCBI)