Products 1094428-30-4
CAS 1094428-30-4 is the registry number for 3,4-Dihydro-1,4-benzoxazine-3-one 6-oxoacetic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetic acid (CAS 1094428-30-4) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetic acid. InChIKey: HZWBBUVIXOGMGQ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetic acid |
| InChIKey | HZWBBUVIXOGMGQ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C(=O)C(=O)O |
Computed by PubChem (NCBI)