cas: 93-35-6 — see every product listed under this CAS number, including other names
7-Hydroxycoumarin, 97% (CAS 93-35-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M05765-1G |
| cas | 93-35-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 50g | 268.67 Pln | |
| Fluorochem | 100g | 419.66 Pln | |
| Fluorochem | 500g | 1606.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Umbelliferone is a hydroxycoumarin that is coumarin substituted by a hydroxy group ay position 7. It has a role as a fluorescent probe, a plant metabolite and a food component.
Source: ChEBI
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 7-hydroxychromen-2-one |
| InChIKey | ORHBXUUXSCNDEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)O |
Computed by PubChem (NCBI)