cas: 20780-78-3 — see every product listed under this CAS number, including other names
7-Iodoindoline-2,3-dione (CAS 20780-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091669-100MG |
| cas | 20780-78-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 565.44 Pln | |
| Fluorochem | 1g | 1403.69 Pln | |
| Fluorochem | 5g | 4746.26 Pln |
| delivery time | 3-4 weeks |
|---|
7-iodo-1H-indole-2,3-dione (CAS 20780-78-3) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 7-iodo-1H-indole-2,3-dione. InChIKey: RLGIFVDILDEIHL-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 7-iodo-1H-indole-2,3-dione |
| InChIKey | RLGIFVDILDEIHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)NC(=O)C2=O |
Computed by PubChem (NCBI)