cas: 1820687-16-8 — see every product listed under this CAS number, including other names
7-Methoxy-6-nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%, 95% (CAS 1820687-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134C0-100mg |
| cas | 1820687-16-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2488.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-methoxy-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1820687-16-8) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 7-methoxy-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: WDNQVGPQFZJNRK-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O3 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 7-methoxy-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | WDNQVGPQFZJNRK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCNCC2=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)