CAS 1187930-80-8 appears in our catalog under these names: 3-(4-Nitrophenoxy)pyrrolidine hydrochloride, 95%, 3-(4-Nitrophenoxy)pyrrolidine hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-(4-nitrophenoxy)pyrrolidine;hydrochloride (CAS 1187930-80-8) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 3-(4-nitrophenoxy)pyrrolidine;hydrochloride. InChIKey: KMTLAWJEKPIRFL-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O3 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 3-(4-nitrophenoxy)pyrrolidine;hydrochloride |
| InChIKey | KMTLAWJEKPIRFL-UHFFFAOYSA-N |
| SMILES | C1CNCC1OC2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)